C33H51NO3 — CID 4595523
cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 4595523) has the molecular formula C33H51NO3 and a molecular weight of 509.78 g/mol. Its IUPAC name is cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 4595523 |
| Molecular Formula | C33H51NO3 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.39 |
| IUPAC Name | cyclohexyl-[5,13-dihydroxy-6,10-dimethyl-5-[[methyl(propyl)amino]methyl]-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CCCN(C)CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C33H51NO3/c1-5-19-34(4)22-32(37)16-13-27-30(32,3)15-12-26-29(2)14-11-24(35)20-31(29)17-18-33(26,27)25(21-31)28(36)23-9-7-6-8-10-23/h17-18,21,23-24,26-27,35,37H,5-16,19-20,22H2,1-4H3 |
| InChIKey | XUTMTVULRZNNRB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|