C19H20N4O2S — CID 4595747
1-(2-methyl-5-nitrophenyl)-3-(5-methylthiophen-2-yl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine (PubChem CID 4595747) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-(2-methyl-5-nitrophenyl)-3-(5-methylthiophen-2-yl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine.
| Compound Name | 1-(2-methyl-5-nitrophenyl)-3-(5-methylthiophen-2-yl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 4595747 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-(2-methyl-5-nitrophenyl)-3-(5-methylthiophen-2-yl)-5,6,7,8-tetrahydro-4H-pyrazolo[5,4-b]azepine |
| SMILES | Cc1ccc(-c2nn(-c3cc([N+](=O)[O-])ccc3C)c3c2CCCCN3)s1 |
| InChI | InChI=1S/C19H20N4O2S/c1-12-6-8-14(23(24)25)11-16(12)22-19-15(5-3-4-10-20-19)18(21-22)17-9-7-13(2)26-17/h6-9,11,20H,3-5,10H2,1-2H3 |
| InChIKey | HNWNIWJTWRFQIR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|