About 4-bromo-N'-butylbenzohydrazide
4-bromo-N'-butylbenzohydrazide (PubChem CID 4596836) has the molecular formula C11H15BrN2O
and a molecular weight of 271.16 g/mol. Its IUPAC name is 4-bromo-N'-butylbenzohydrazide.
Molecular Properties
| Compound Name | 4-bromo-N'-butylbenzohydrazide |
| PubChem CID | 4596836 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 4-bromo-N'-butylbenzohydrazide |
| SMILES | CCCCNNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H15BrN2O/c1-2-3-8-13-14-11(15)9-4-6-10(12)7-5-9/h4-7,13H,2-3,8H2,1H3,(H,14,15) |
| InChIKey | BVQCFCYPFJOOAV-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N'-butylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N'-butylbenzohydrazide?
The IUPAC name of 4-bromo-N'-butylbenzohydrazide (CID 4596836) is 4-bromo-N'-butylbenzohydrazide.
What is the SMILES notation for 4-bromo-N'-butylbenzohydrazide?
The canonical SMILES for 4-bromo-N'-butylbenzohydrazide is CCCCNNC(=O)c1ccc(Br)cc1.
What is the InChIKey of 4-bromo-N'-butylbenzohydrazide?
The InChIKey is BVQCFCYPFJOOAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O/c1-2-3-8-13-14-11(15)9-4-6-10(12)7-5-9/h4-7,13H,2-3,8H2,1H3,(H,14,15).
What are the key properties of 4-bromo-N'-butylbenzohydrazide?
4-bromo-N'-butylbenzohydrazide has a molecular weight of 271.16 g/mol, XLogP of 2.48, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N'-butylbenzohydrazide is sourced from PubChem (CID 4596836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).