C17H19N3O4 — CID 4596963
ethyl 2-(4-methoxyquinoline-2-carbonyl)pyrazolidine-1-carboxylate (PubChem CID 4596963) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is ethyl 2-(4-methoxyquinoline-2-carbonyl)pyrazolidine-1-carboxylate.
| Compound Name | ethyl 2-(4-methoxyquinoline-2-carbonyl)pyrazolidine-1-carboxylate |
|---|---|
| PubChem CID | 4596963 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | ethyl 2-(4-methoxyquinoline-2-carbonyl)pyrazolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN1C(=O)c1cc(OC)c2ccccc2n1 |
| InChI | InChI=1S/C17H19N3O4/c1-3-24-17(22)20-10-6-9-19(20)16(21)14-11-15(23-2)12-7-4-5-8-13(12)18-14/h4-5,7-8,11H,3,6,9-10H2,1-2H3 |
| InChIKey | DELLENQMHRUZII-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |