About 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine
2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine (PubChem CID 4597240) has the molecular formula C23H20ClN2O2P
and a molecular weight of 422.85 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine |
| PubChem CID | 4597240 |
| Molecular Formula | C23H20ClN2O2P |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine |
| SMILES | CN(C)c1oc(-c2ccccc2Cl)nc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20ClN2O2P/c1-26(2)23-22(25-21(28-23)19-15-9-10-16-20(19)24)29(27,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-16H,1-2H3 |
| InChIKey | WVBGVKOFTVPUES-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine?
The IUPAC name of 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine (CID 4597240) is 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine.
What is the SMILES notation for 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine?
The canonical SMILES for 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine is CN(C)c1oc(-c2ccccc2Cl)nc1P(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine?
The InChIKey is WVBGVKOFTVPUES-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20ClN2O2P/c1-26(2)23-22(25-21(28-23)19-15-9-10-16-20(19)24)29(27,17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-16H,1-2H3.
What are the key properties of 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine?
2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine has a molecular weight of 422.85 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-4-diphenylphosphoryl-N,N-dimethyl-1,3-oxazol-5-amine is sourced from PubChem (CID 4597240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).