C19H19N3O4S2 — CID 4597948
2-(7-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide (PubChem CID 4597948) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-(7-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-(7-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 4597948 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 2-(7-methoxy-4-methylquinolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc2c(C)cc(SCC(=O)Nc3ccc(S(N)(=O)=O)cc3)nc2c1 |
| InChI | InChI=1S/C19H19N3O4S2/c1-12-9-19(22-17-10-14(26-2)5-8-16(12)17)27-11-18(23)21-13-3-6-15(7-4-13)28(20,24)25/h3-10H,11H2,1-2H3,(H,21,23)(H2,20,24,25) |
| InChIKey | DBLJFQNKBVJTGA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |