About 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide
4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide (PubChem CID 4598116) has the molecular formula C23H22N2O4S
and a molecular weight of 422.51 g/mol. Its IUPAC name is 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide |
| PubChem CID | 4598116 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NN=C2CC(c3ccccc3)Oc3ccccc32)cc1 |
| InChI | InChI=1S/C23H22N2O4S/c1-2-28-18-12-14-19(15-13-18)30(26,27)25-24-21-16-23(17-8-4-3-5-9-17)29-22-11-7-6-10-20(21)22/h3-15,23,25H,2,16H2,1H3 |
| InChIKey | TVQDTDRDHPFHTJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide?
The IUPAC name of 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide (CID 4598116) is 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide.
What is the SMILES notation for 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide?
The canonical SMILES for 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide is CCOc1ccc(S(=O)(=O)NN=C2CC(c3ccccc3)Oc3ccccc32)cc1.
What is the InChIKey of 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide?
The InChIKey is TVQDTDRDHPFHTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O4S/c1-2-28-18-12-14-19(15-13-18)30(26,27)25-24-21-16-23(17-8-4-3-5-9-17)29-22-11-7-6-10-20(21)22/h3-15,23,25H,2,16H2,1H3.
What are the key properties of 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide?
4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide has a molecular weight of 422.51 g/mol, XLogP of 4.29, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-N-[(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]benzenesulfonamide is sourced from PubChem (CID 4598116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).