About 5-(diethylamino)-1,1-diphenylpentan-1-ol
5-(diethylamino)-1,1-diphenylpentan-1-ol (PubChem CID 4598397) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is 5-(diethylamino)-1,1-diphenylpentan-1-ol.
Molecular Properties
| Compound Name | 5-(diethylamino)-1,1-diphenylpentan-1-ol |
| PubChem CID | 4598397 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 5-(diethylamino)-1,1-diphenylpentan-1-ol |
| SMILES | CCN(CC)CCCCC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NO/c1-3-22(4-2)18-12-11-17-21(23,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-16,23H,3-4,11-12,17-18H2,1-2H3 |
| InChIKey | JKEDFZXWIAOGGJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethylamino)-1,1-diphenylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylamino)-1,1-diphenylpentan-1-ol?
The IUPAC name of 5-(diethylamino)-1,1-diphenylpentan-1-ol (CID 4598397) is 5-(diethylamino)-1,1-diphenylpentan-1-ol.
What is the SMILES notation for 5-(diethylamino)-1,1-diphenylpentan-1-ol?
The canonical SMILES for 5-(diethylamino)-1,1-diphenylpentan-1-ol is CCN(CC)CCCCC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 5-(diethylamino)-1,1-diphenylpentan-1-ol?
The InChIKey is JKEDFZXWIAOGGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO/c1-3-22(4-2)18-12-11-17-21(23,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-10,13-16,23H,3-4,11-12,17-18H2,1-2H3.
What are the key properties of 5-(diethylamino)-1,1-diphenylpentan-1-ol?
5-(diethylamino)-1,1-diphenylpentan-1-ol has a molecular weight of 311.47 g/mol, XLogP of 4.43, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylamino)-1,1-diphenylpentan-1-ol is sourced from PubChem (CID 4598397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).