About [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate
[4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate (PubChem CID 4599314) has the molecular formula C23H17BrN2O4S
and a molecular weight of 497.37 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate.
Molecular Properties
| Compound Name | [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate |
| PubChem CID | 4599314 |
| Molecular Formula | C23H17BrN2O4S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate |
| SMILES | Cc1nn(-c2ccccc2)c(OC(=O)c2ccc(Br)cc2)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H17BrN2O4S/c1-16-21(31(28,29)20-10-6-3-7-11-20)22(26(25-16)19-8-4-2-5-9-19)30-23(27)17-12-14-18(24)15-13-17/h2-15H,1H3 |
| InChIKey | XRSLDLGBPCVGTC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate?
The IUPAC name of [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate (CID 4599314) is [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate.
What is the SMILES notation for [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate?
The canonical SMILES for [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate is Cc1nn(-c2ccccc2)c(OC(=O)c2ccc(Br)cc2)c1S(=O)(=O)c1ccccc1.
What is the InChIKey of [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate?
The InChIKey is XRSLDLGBPCVGTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17BrN2O4S/c1-16-21(31(28,29)20-10-6-3-7-11-20)22(26(25-16)19-8-4-2-5-9-19)30-23(27)17-12-14-18(24)15-13-17/h2-15H,1H3.
What are the key properties of [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate?
[4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate has a molecular weight of 497.37 g/mol, XLogP of 5.00, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(benzenesulfonyl)-3-methyl-1-phenylpyrazol-5-yl] 4-bromobenzoate is sourced from PubChem (CID 4599314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).