C16H19N3O3 — CID 4599542
[2-(4-aminophenyl)-1,3-oxazol-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone (PubChem CID 4599542) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1,3-oxazol-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone.
| Compound Name | [2-(4-aminophenyl)-1,3-oxazol-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 4599542 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | [2-(4-aminophenyl)-1,3-oxazol-4-yl]-(2,6-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2coc(-c3ccc(N)cc3)n2)CC(C)O1 |
| InChI | InChI=1S/C16H19N3O3/c1-10-7-19(8-11(2)22-10)16(20)14-9-21-15(18-14)12-3-5-13(17)6-4-12/h3-6,9-11H,7-8,17H2,1-2H3 |
| InChIKey | PDXPSBHJVKTMLW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|