C19H23N4O+ — CID 4599859
3-[4-(dimethylamino)phenyl]-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one (PubChem CID 4599859) has the molecular formula C19H23N4O+ and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one.
| Compound Name | 3-[4-(dimethylamino)phenyl]-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
|---|---|
| PubChem CID | 4599859 |
| Molecular Formula | C19H23N4O+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-2-pyridin-2-yl-3,4,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-4-ium-1-one |
| SMILES | CN(C)c1ccc(C2N(c3ccccn3)C(=O)C3CCC[NH+]32)cc1 |
| InChI | InChI=1S/C19H22N4O/c1-21(2)15-10-8-14(9-11-15)18-22-13-5-6-16(22)19(24)23(18)17-7-3-4-12-20-17/h3-4,7-12,16,18H,5-6,13H2,1-2H3/p+1 |
| InChIKey | WGPKRDZVPARWKE-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 40.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|