C23H25ClN4O3 — CID 46001056
4-[[5-(3-chlorophenoxy)-2-methyl-3-oxopyridazin-4-yl]amino]-N-(3-methylbutyl)benzamide (PubChem CID 46001056) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 4-[[5-(3-chlorophenoxy)-2-methyl-3-oxopyridazin-4-yl]amino]-N-(3-methylbutyl)benzamide.
| Compound Name | 4-[[5-(3-chlorophenoxy)-2-methyl-3-oxopyridazin-4-yl]amino]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 46001056 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 4-[[5-(3-chlorophenoxy)-2-methyl-3-oxopyridazin-4-yl]amino]-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)CCNC(=O)c1ccc(Nc2c(Oc3cccc(Cl)c3)cnn(C)c2=O)cc1 |
| InChI | InChI=1S/C23H25ClN4O3/c1-15(2)11-12-25-22(29)16-7-9-18(10-8-16)27-21-20(14-26-28(3)23(21)30)31-19-6-4-5-17(24)13-19/h4-10,13-15,27H,11-12H2,1-3H3,(H,25,29) |
| InChIKey | FCYOZXCQYFBJTL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |