C16H13F5N2OS — CID 4600213
N-(2,3,4,5,6-pentafluorophenyl)-3-(2-pyridin-2-ylethylsulfanyl)propanamide (PubChem CID 4600213) has the molecular formula C16H13F5N2OS and a molecular weight of 376.35 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentafluorophenyl)-3-(2-pyridin-2-ylethylsulfanyl)propanamide.
| Compound Name | N-(2,3,4,5,6-pentafluorophenyl)-3-(2-pyridin-2-ylethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 4600213 |
| Molecular Formula | C16H13F5N2OS |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-(2,3,4,5,6-pentafluorophenyl)-3-(2-pyridin-2-ylethylsulfanyl)propanamide |
| SMILES | O=C(CCSCCc1ccccn1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H13F5N2OS/c17-11-12(18)14(20)16(15(21)13(11)19)23-10(24)5-8-25-7-4-9-3-1-2-6-22-9/h1-3,6H,4-5,7-8H2,(H,23,24) |
| InChIKey | BZCQIAQWGOFEPY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|