C21H20N4O4 — CID 46004301
4-benzyl-6-(morpholine-4-carbonyl)-2-phenyl-1,2,4-triazine-3,5-dione (PubChem CID 46004301) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-benzyl-6-(morpholine-4-carbonyl)-2-phenyl-1,2,4-triazine-3,5-dione.
| Compound Name | 4-benzyl-6-(morpholine-4-carbonyl)-2-phenyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 46004301 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4-benzyl-6-(morpholine-4-carbonyl)-2-phenyl-1,2,4-triazine-3,5-dione |
| SMILES | O=C(c1nn(-c2ccccc2)c(=O)n(Cc2ccccc2)c1=O)N1CCOCC1 |
| InChI | InChI=1S/C21H20N4O4/c26-19(23-11-13-29-14-12-23)18-20(27)24(15-16-7-3-1-4-8-16)21(28)25(22-18)17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | OFJHNLRIFSAHSY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |