C21H21FN4O4 — CID 46004315
4-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-2-phenyl-1,2,4-triazine-6-carboxamide (PubChem CID 46004315) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-2-phenyl-1,2,4-triazine-6-carboxamide.
| Compound Name | 4-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-2-phenyl-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 46004315 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-2-phenyl-1,2,4-triazine-6-carboxamide |
| SMILES | COCCCNC(=O)c1nn(-c2ccccc2)c(=O)n(Cc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C21H21FN4O4/c1-30-13-5-12-23-19(27)18-20(28)25(14-15-8-10-16(22)11-9-15)21(29)26(24-18)17-6-3-2-4-7-17/h2-4,6-11H,5,12-14H2,1H3,(H,23,27) |
| InChIKey | PWTCRDXSNRPWBQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|