C20H18ClFN4O4 — CID 46005802
4-[(2-chlorophenyl)methyl]-2-(3-fluorophenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide (PubChem CID 46005802) has the molecular formula C20H18ClFN4O4 and a molecular weight of 432.84 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-2-(3-fluorophenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide.
| Compound Name | 4-[(2-chlorophenyl)methyl]-2-(3-fluorophenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 46005802 |
| Molecular Formula | C20H18ClFN4O4 |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-2-(3-fluorophenyl)-N-(2-methoxyethyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
| SMILES | COCCNC(=O)c1nn(-c2cccc(F)c2)c(=O)n(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C20H18ClFN4O4/c1-30-10-9-23-18(27)17-19(28)25(12-13-5-2-3-8-16(13)21)20(29)26(24-17)15-7-4-6-14(22)11-15/h2-8,11H,9-10,12H2,1H3,(H,23,27) |
| InChIKey | FVYKSIUKDLDNKC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|