C23H25ClN4O5 — CID 46006003
2-(3-chloro-4-methylphenyl)-4-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide (PubChem CID 46006003) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-4-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide.
| Compound Name | 2-(3-chloro-4-methylphenyl)-4-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 46006003 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-4-[(3-methoxyphenyl)methyl]-N-(3-methoxypropyl)-3,5-dioxo-1,2,4-triazine-6-carboxamide |
| SMILES | COCCCNC(=O)c1nn(-c2ccc(C)c(Cl)c2)c(=O)n(Cc2cccc(OC)c2)c1=O |
| InChI | InChI=1S/C23H25ClN4O5/c1-15-8-9-17(13-19(15)24)28-23(31)27(14-16-6-4-7-18(12-16)33-3)22(30)20(26-28)21(29)25-10-5-11-32-2/h4,6-9,12-13H,5,10-11,14H2,1-3H3,(H,25,29) |
| InChIKey | VBIRMMIKHZVQDF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|