C32H33N5O3S — CID 46006242
4-methyl-N-[2-oxo-2-[4-[6-(4-phenylphenyl)pyridazin-3-yl]piperazin-1-yl]ethyl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 46006242) has the molecular formula C32H33N5O3S and a molecular weight of 567.72 g/mol. Its IUPAC name is 4-methyl-N-[2-oxo-2-[4-[6-(4-phenylphenyl)pyridazin-3-yl]piperazin-1-yl]ethyl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[2-oxo-2-[4-[6-(4-phenylphenyl)pyridazin-3-yl]piperazin-1-yl]ethyl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 46006242 |
| Molecular Formula | C32H33N5O3S |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 4-methyl-N-[2-oxo-2-[4-[6-(4-phenylphenyl)pyridazin-3-yl]piperazin-1-yl]ethyl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(CC(=O)N1CCN(c2ccc(-c3ccc(-c4ccccc4)cc3)nn2)CC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H33N5O3S/c1-3-19-37(41(39,40)29-15-9-25(2)10-16-29)24-32(38)36-22-20-35(21-23-36)31-18-17-30(33-34-31)28-13-11-27(12-14-28)26-7-5-4-6-8-26/h3-18H,1,19-24H2,2H3 |
| InChIKey | YVNSKWHMTGOTPF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|