About 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol
1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol (PubChem CID 46007253) has the molecular formula C25H28FNO
and a molecular weight of 377.50 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol |
| PubChem CID | 46007253 |
| Molecular Formula | C25H28FNO |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol |
| SMILES | Cc1ccc(CN(Cc2ccc(F)cc2)CC(O)Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C25H28FNO/c1-19-8-11-23(20(2)14-19)17-27(16-22-9-12-24(26)13-10-22)18-25(28)15-21-6-4-3-5-7-21/h3-14,25,28H,15-18H2,1-2H3 |
| InChIKey | JOINITSSBQMBFL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol?
The IUPAC name of 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol (CID 46007253) is 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol.
What is the SMILES notation for 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol?
The canonical SMILES for 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol is Cc1ccc(CN(Cc2ccc(F)cc2)CC(O)Cc2ccccc2)c(C)c1.
What is the InChIKey of 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol?
The InChIKey is JOINITSSBQMBFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28FNO/c1-19-8-11-23(20(2)14-19)17-27(16-22-9-12-24(26)13-10-22)18-25(28)15-21-6-4-3-5-7-21/h3-14,25,28H,15-18H2,1-2H3.
What are the key properties of 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol?
1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol has a molecular weight of 377.50 g/mol, XLogP of 5.05, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-dimethylphenyl)methyl-[(4-fluorophenyl)methyl]amino]-3-phenylpropan-2-ol is sourced from PubChem (CID 46007253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).