C26H36N2O3S — CID 4600732
N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-hydroxy-3,5-dimethylphenyl)methylsulfanyl]acetamide (PubChem CID 4600732) has the molecular formula C26H36N2O3S and a molecular weight of 456.65 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-hydroxy-3,5-dimethylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-hydroxy-3,5-dimethylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 4600732 |
| Molecular Formula | C26H36N2O3S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | N-[(3,5-ditert-butyl-4-hydroxyphenyl)methylideneamino]-2-[(4-hydroxy-3,5-dimethylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cc(CSCC(=O)NN=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C)c1O |
| InChI | InChI=1S/C26H36N2O3S/c1-16-9-19(10-17(2)23(16)30)14-32-15-22(29)28-27-13-18-11-20(25(3,4)5)24(31)21(12-18)26(6,7)8/h9-13,30-31H,14-15H2,1-8H3,(H,28,29) |
| InChIKey | IVDODZROAOUTFE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|