C20H25F2NO2 — CID 46007666
1-[bis[(4-fluorophenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 46007666) has the molecular formula C20H25F2NO2 and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-[bis[(4-fluorophenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[bis[(4-fluorophenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 46007666 |
| Molecular Formula | C20H25F2NO2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-[bis[(4-fluorophenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CN(Cc1ccc(F)cc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H25F2NO2/c1-15(2)25-14-20(24)13-23(11-16-3-7-18(21)8-4-16)12-17-5-9-19(22)10-6-17/h3-10,15,20,24H,11-14H2,1-2H3 |
| InChIKey | AKUYONCGNFAUIP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |