About [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate
[3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate (PubChem CID 46007927) has the molecular formula C21H25F2NO3
and a molecular weight of 377.43 g/mol. Its IUPAC name is [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate.
Molecular Properties
| Compound Name | [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate |
| PubChem CID | 46007927 |
| Molecular Formula | C21H25F2NO3 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OCC(O)CN(Cc1ccccc1)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C21H25F2NO3/c1-2-6-21(26)27-15-19(25)14-24(12-16-7-4-3-5-8-16)13-17-9-10-18(22)11-20(17)23/h3-5,7-11,19,25H,2,6,12-15H2,1H3 |
| InChIKey | PUKZNQVXFFUGSE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate?
The IUPAC name of [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate (CID 46007927) is [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate.
What is the SMILES notation for [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate?
The canonical SMILES for [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate is CCCC(=O)OCC(O)CN(Cc1ccccc1)Cc1ccc(F)cc1F.
What is the InChIKey of [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate?
The InChIKey is PUKZNQVXFFUGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25F2NO3/c1-2-6-21(26)27-15-19(25)14-24(12-16-7-4-3-5-8-16)13-17-9-10-18(22)11-20(17)23/h3-5,7-11,19,25H,2,6,12-15H2,1H3.
What are the key properties of [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate?
[3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate has a molecular weight of 377.43 g/mol, XLogP of 3.67, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[benzyl-[(2,4-difluorophenyl)methyl]amino]-2-hydroxypropyl] butanoate is sourced from PubChem (CID 46007927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).