C22H24N2O3S — CID 46008175
N-[[2-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylfuran-2-carboxamide (PubChem CID 46008175) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[[2-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylfuran-2-carboxamide.
| Compound Name | N-[[2-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylfuran-2-carboxamide |
|---|---|
| PubChem CID | 46008175 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[[2-[(2-propan-2-ylphenoxy)methyl]-1,3-thiazol-4-yl]methyl]-N-prop-2-enylfuran-2-carboxamide |
| SMILES | C=CCN(Cc1csc(COc2ccccc2C(C)C)n1)C(=O)c1ccco1 |
| InChI | InChI=1S/C22H24N2O3S/c1-4-11-24(22(25)20-10-7-12-26-20)13-17-15-28-21(23-17)14-27-19-9-6-5-8-18(19)16(2)3/h4-10,12,15-16H,1,11,13-14H2,2-3H3 |
| InChIKey | UHLPILFXOLFGLG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|