C27H22FN3O3 — CID 46013400
[4-[4-(cyclopropanecarbonylamino)phenyl]-3-(2-fluorophenyl)-1-phenylpyrazol-5-yl] acetate (PubChem CID 46013400) has the molecular formula C27H22FN3O3 and a molecular weight of 455.49 g/mol. Its IUPAC name is [4-[4-(cyclopropanecarbonylamino)phenyl]-3-(2-fluorophenyl)-1-phenylpyrazol-5-yl] acetate.
| Compound Name | [4-[4-(cyclopropanecarbonylamino)phenyl]-3-(2-fluorophenyl)-1-phenylpyrazol-5-yl] acetate |
|---|---|
| PubChem CID | 46013400 |
| Molecular Formula | C27H22FN3O3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [4-[4-(cyclopropanecarbonylamino)phenyl]-3-(2-fluorophenyl)-1-phenylpyrazol-5-yl] acetate |
| SMILES | CC(=O)Oc1c(-c2ccc(NC(=O)C3CC3)cc2)c(-c2ccccc2F)nn1-c1ccccc1 |
| InChI | InChI=1S/C27H22FN3O3/c1-17(32)34-27-24(18-13-15-20(16-14-18)29-26(33)19-11-12-19)25(22-9-5-6-10-23(22)28)30-31(27)21-7-3-2-4-8-21/h2-10,13-16,19H,11-12H2,1H3,(H,29,33) |
| InChIKey | XZWPHZXORFETGD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |