About N,N'-bis(2,4-dimethoxyphenyl)hexanediamide
N,N'-bis(2,4-dimethoxyphenyl)hexanediamide (PubChem CID 4601418) has the molecular formula C22H28N2O6
and a molecular weight of 416.47 g/mol. Its IUPAC name is N,N'-bis(2,4-dimethoxyphenyl)hexanediamide.
Molecular Properties
| Compound Name | N,N'-bis(2,4-dimethoxyphenyl)hexanediamide |
| PubChem CID | 4601418 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N,N'-bis(2,4-dimethoxyphenyl)hexanediamide |
| SMILES | COc1ccc(NC(=O)CCCCC(=O)Nc2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O6/c1-27-15-9-11-17(19(13-15)29-3)23-21(25)7-5-6-8-22(26)24-18-12-10-16(28-2)14-20(18)30-4/h9-14H,5-8H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | VMAVWEAARBQORG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(2,4-dimethoxyphenyl)hexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(2,4-dimethoxyphenyl)hexanediamide?
The IUPAC name of N,N'-bis(2,4-dimethoxyphenyl)hexanediamide (CID 4601418) is N,N'-bis(2,4-dimethoxyphenyl)hexanediamide.
What is the SMILES notation for N,N'-bis(2,4-dimethoxyphenyl)hexanediamide?
The canonical SMILES for N,N'-bis(2,4-dimethoxyphenyl)hexanediamide is COc1ccc(NC(=O)CCCCC(=O)Nc2ccc(OC)cc2OC)c(OC)c1.
What is the InChIKey of N,N'-bis(2,4-dimethoxyphenyl)hexanediamide?
The InChIKey is VMAVWEAARBQORG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O6/c1-27-15-9-11-17(19(13-15)29-3)23-21(25)7-5-6-8-22(26)24-18-12-10-16(28-2)14-20(18)30-4/h9-14H,5-8H2,1-4H3,(H,23,25)(H,24,26).
What are the key properties of N,N'-bis(2,4-dimethoxyphenyl)hexanediamide?
N,N'-bis(2,4-dimethoxyphenyl)hexanediamide has a molecular weight of 416.47 g/mol, XLogP of 3.86, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(2,4-dimethoxyphenyl)hexanediamide is sourced from PubChem (CID 4601418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).