C24H29FN2O3 — CID 46014215
1-[(3-fluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 46014215) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | 1-[(3-fluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 46014215 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl-[[3-(2-methylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOCC(O)CN(Cc1cccc(F)c1)CC1CC(c2ccccc2C)=NO1 |
| InChI | InChI=1S/C24H29FN2O3/c1-3-11-29-17-21(28)15-27(14-19-8-6-9-20(25)12-19)16-22-13-24(26-30-22)23-10-5-4-7-18(23)2/h3-10,12,21-22,28H,1,11,13-17H2,2H3 |
| InChIKey | QDOJHBXEYVTYIG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|