C24H35N3O3S — CID 46016373
2-[[cyclohexyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 46016373) has the molecular formula C24H35N3O3S and a molecular weight of 445.63 g/mol. Its IUPAC name is 2-[[cyclohexyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[[cyclohexyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46016373 |
| Molecular Formula | C24H35N3O3S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-[[cyclohexyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]methyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C=CCOCC(O)CN(Cc1nc2sc3c(c2c(=O)[nH]1)CCC(C)C3)C1CCCCC1 |
| InChI | InChI=1S/C24H35N3O3S/c1-3-11-30-15-18(28)13-27(17-7-5-4-6-8-17)14-21-25-23(29)22-19-10-9-16(2)12-20(19)31-24(22)26-21/h3,16-18,28H,1,4-15H2,2H3,(H,25,26,29) |
| InChIKey | GBHOICHOTZDMIM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|