About 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one
3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one (PubChem CID 46017241) has the molecular formula C19H24N2O3S
and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one |
| PubChem CID | 46017241 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one |
| SMILES | COCCN1C(=O)C2(SCCN2C(=O)C2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O3S/c1-24-12-10-20-16-9-5-4-8-15(16)19(18(20)23)21(11-13-25-19)17(22)14-6-2-3-7-14/h4-5,8-9,14H,2-3,6-7,10-13H2,1H3 |
| InChIKey | DZFQSEWFVASNPE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The IUPAC name of 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one (CID 46017241) is 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one.
What is the SMILES notation for 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The canonical SMILES for 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one is COCCN1C(=O)C2(SCCN2C(=O)C2CCCC2)c2ccccc21.
What is the InChIKey of 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The InChIKey is DZFQSEWFVASNPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O3S/c1-24-12-10-20-16-9-5-4-8-15(16)19(18(20)23)21(11-13-25-19)17(22)14-6-2-3-7-14/h4-5,8-9,14H,2-3,6-7,10-13H2,1H3.
What are the key properties of 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one?
3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one has a molecular weight of 360.48 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopentanecarbonyl)-1'-(2-methoxyethyl)spiro[1,3-thiazolidine-2,3'-indole]-2'-one is sourced from PubChem (CID 46017241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).