C15H23NO — CID 4601922
N-(4-butylphenyl)-2,2-dimethylpropanamide (PubChem CID 4601922) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is N-(4-butylphenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(4-butylphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 4601922 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-(4-butylphenyl)-2,2-dimethylpropanamide |
| SMILES | CCCCc1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23NO/c1-5-6-7-12-8-10-13(11-9-12)16-14(17)15(2,3)4/h8-11H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | ZPASUSFSPSBZOS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |