C23H33N3O3 — CID 46020042
3-methyl-N-[2-oxo-2-piperidin-1-yl-1-(1-propanoylpiperidin-4-yl)ethyl]benzamide (PubChem CID 46020042) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-methyl-N-[2-oxo-2-piperidin-1-yl-1-(1-propanoylpiperidin-4-yl)ethyl]benzamide.
| Compound Name | 3-methyl-N-[2-oxo-2-piperidin-1-yl-1-(1-propanoylpiperidin-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 46020042 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 3-methyl-N-[2-oxo-2-piperidin-1-yl-1-(1-propanoylpiperidin-4-yl)ethyl]benzamide |
| SMILES | CCC(=O)N1CCC(C(NC(=O)c2cccc(C)c2)C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C23H33N3O3/c1-3-20(27)25-14-10-18(11-15-25)21(23(29)26-12-5-4-6-13-26)24-22(28)19-9-7-8-17(2)16-19/h7-9,16,18,21H,3-6,10-15H2,1-2H3,(H,24,28) |
| InChIKey | VVALJOVOIVCKBR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |