C27H32FN3O3 — CID 46020400
N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]-4-methylbenzamide (PubChem CID 46020400) has the molecular formula C27H32FN3O3 and a molecular weight of 465.57 g/mol. Its IUPAC name is N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]-4-methylbenzamide.
| Compound Name | N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46020400 |
| Molecular Formula | C27H32FN3O3 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C(=O)N2CCCCC2)C2CCN(C(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H32FN3O3/c1-19-8-10-21(11-9-19)25(32)29-24(27(34)30-14-3-2-4-15-30)20-12-16-31(17-13-20)26(33)22-6-5-7-23(28)18-22/h5-11,18,20,24H,2-4,12-17H2,1H3,(H,29,32) |
| InChIKey | WWDXJSWJPDXNKX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |