C21H20ClNO4S — CID 46021895
N-[(4-chlorophenyl)methyl]-N-(3,4-dimethoxyphenyl)benzenesulfonamide (PubChem CID 46021895) has the molecular formula C21H20ClNO4S and a molecular weight of 417.91 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N-(3,4-dimethoxyphenyl)benzenesulfonamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N-(3,4-dimethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46021895 |
| Molecular Formula | C21H20ClNO4S |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N-(3,4-dimethoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(N(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H20ClNO4S/c1-26-20-13-12-18(14-21(20)27-2)23(15-16-8-10-17(22)11-9-16)28(24,25)19-6-4-3-5-7-19/h3-14H,15H2,1-2H3 |
| InChIKey | PYABAFUOLZATJA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |