C21H21NO4S — CID 46022004
N-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 46022004) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46022004 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-(4-methoxyphenyl)-N-[(2-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(N(Cc2ccccc2OC)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-25-19-14-12-18(13-15-19)22(16-17-8-6-7-11-21(17)26-2)27(23,24)20-9-4-3-5-10-20/h3-15H,16H2,1-2H3 |
| InChIKey | VQIBQCHTPFEZLX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |