C20H17BrFNO2S — CID 46022691
N-(3-bromophenyl)-2-fluoro-N-[(2-methylphenyl)methyl]benzenesulfonamide (PubChem CID 46022691) has the molecular formula C20H17BrFNO2S and a molecular weight of 434.33 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-fluoro-N-[(2-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(3-bromophenyl)-2-fluoro-N-[(2-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46022691 |
| Molecular Formula | C20H17BrFNO2S |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | N-(3-bromophenyl)-2-fluoro-N-[(2-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccccc1CN(c1cccc(Br)c1)S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C20H17BrFNO2S/c1-15-7-2-3-8-16(15)14-23(18-10-6-9-17(21)13-18)26(24,25)20-12-5-4-11-19(20)22/h2-13H,14H2,1H3 |
| InChIKey | CEIGCPAXBDDZDA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |