C23H34N4O4 — CID 46024001
2-cyclopentyl-N,N-diethyl-2-[4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]acetamide (PubChem CID 46024001) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-cyclopentyl-N,N-diethyl-2-[4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N,N-diethyl-2-[4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46024001 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-cyclopentyl-N,N-diethyl-2-[4-(4-methyl-3-nitrobenzoyl)piperazin-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)C(C1CCCC1)N1CCN(C(=O)c2ccc(C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C23H34N4O4/c1-4-24(5-2)23(29)21(18-8-6-7-9-18)25-12-14-26(15-13-25)22(28)19-11-10-17(3)20(16-19)27(30)31/h10-11,16,18,21H,4-9,12-15H2,1-3H3 |
| InChIKey | QZQGWVLPFZMGQJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|