C25H29ClFN3O2 — CID 46024575
2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 46024575) has the molecular formula C25H29ClFN3O2 and a molecular weight of 457.98 g/mol. Its IUPAC name is 2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46024575 |
| Molecular Formula | C25H29ClFN3O2 |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-[4-(4-chlorobenzoyl)piperazin-1-yl]-2-cyclopentyl-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | O=C(NCc1cccc(F)c1)C(C1CCCC1)N1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H29ClFN3O2/c26-21-10-8-20(9-11-21)25(32)30-14-12-29(13-15-30)23(19-5-1-2-6-19)24(31)28-17-18-4-3-7-22(27)16-18/h3-4,7-11,16,19,23H,1-2,5-6,12-15,17H2,(H,28,31) |
| InChIKey | JJOJOQOEGXRWBR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |