C27H34N4O5 — CID 46024690
2-cyclopentyl-N-[2-(2-methoxyphenyl)ethyl]-2-[4-(3-nitrobenzoyl)piperazin-1-yl]acetamide (PubChem CID 46024690) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-(2-methoxyphenyl)ethyl]-2-[4-(3-nitrobenzoyl)piperazin-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-(2-methoxyphenyl)ethyl]-2-[4-(3-nitrobenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46024690 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 2-cyclopentyl-N-[2-(2-methoxyphenyl)ethyl]-2-[4-(3-nitrobenzoyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccccc1CCNC(=O)C(C1CCCC1)N1CCN(C(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C27H34N4O5/c1-36-24-12-5-4-7-20(24)13-14-28-26(32)25(21-8-2-3-9-21)29-15-17-30(18-16-29)27(33)22-10-6-11-23(19-22)31(34)35/h4-7,10-12,19,21,25H,2-3,8-9,13-18H2,1H3,(H,28,32) |
| InChIKey | YXDIVIBSDNEIFL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|