C28H37N3O3 — CID 46025928
1-[[5-(2-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol (PubChem CID 46025928) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is 1-[[5-(2-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol.
| Compound Name | 1-[[5-(2-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 46025928 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | 1-[[5-(2-methoxyphenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1c(C)nn(-c2ccccc2)c1Oc1ccccc1OC)CC(C)C |
| InChI | InChI=1S/C28H37N3O3/c1-6-7-15-24(32)19-30(18-21(2)3)20-25-22(4)29-31(23-13-9-8-10-14-23)28(25)34-27-17-12-11-16-26(27)33-5/h6,8-14,16-17,21,24,32H,1,7,15,18-20H2,2-5H3 |
| InChIKey | DIFZQNXGSABVKQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|