C27H34FN3O2 — CID 46026361
1-[[5-(2-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol (PubChem CID 46026361) has the molecular formula C27H34FN3O2 and a molecular weight of 451.59 g/mol. Its IUPAC name is 1-[[5-(2-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol.
| Compound Name | 1-[[5-(2-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 46026361 |
| Molecular Formula | C27H34FN3O2 |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 1-[[5-(2-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl-(2-methylpropyl)amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1c(-c2ccccc2)nn(C)c1Oc1ccccc1F)CC(C)C |
| InChI | InChI=1S/C27H34FN3O2/c1-5-6-14-22(32)18-31(17-20(2)3)19-23-26(21-12-8-7-9-13-21)29-30(4)27(23)33-25-16-11-10-15-24(25)28/h5,7-13,15-16,20,22,32H,1,6,14,17-19H2,2-4H3 |
| InChIKey | JEBDXFMBQSHPGM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|