C27H38N2O4S — CID 46026732
2-[ethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]-1-[4-[(4-propan-2-ylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone (PubChem CID 46026732) has the molecular formula C27H38N2O4S and a molecular weight of 486.68 g/mol. Its IUPAC name is 2-[ethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]-1-[4-[(4-propan-2-ylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone.
| Compound Name | 2-[ethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]-1-[4-[(4-propan-2-ylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 46026732 |
| Molecular Formula | C27H38N2O4S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[ethyl-(2-hydroxy-3-prop-2-enoxypropyl)amino]-1-[4-[(4-propan-2-ylphenoxy)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]ethanone |
| SMILES | C=CCOCC(O)CN(CC)CC(=O)N1CCc2sccc2C1COc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C27H38N2O4S/c1-5-14-32-18-22(30)16-28(6-2)17-27(31)29-13-11-26-24(12-15-34-26)25(29)19-33-23-9-7-21(8-10-23)20(3)4/h5,7-10,12,15,20,22,25,30H,1,6,11,13-14,16-19H2,2-4H3 |
| InChIKey | ZWZBTBGRLWSRPY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|