C21H23F2NO2 — CID 46028991
1-[3-[(3,5-difluorophenyl)methoxy]piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 46028991) has the molecular formula C21H23F2NO2 and a molecular weight of 359.42 g/mol. Its IUPAC name is 1-[3-[(3,5-difluorophenyl)methoxy]piperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[3-[(3,5-difluorophenyl)methoxy]piperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 46028991 |
| Molecular Formula | C21H23F2NO2 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[3-[(3,5-difluorophenyl)methoxy]piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCCC(OCc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C21H23F2NO2/c22-18-11-17(12-19(23)13-18)15-26-20-7-4-10-24(14-20)21(25)9-8-16-5-2-1-3-6-16/h1-3,5-6,11-13,20H,4,7-10,14-15H2 |
| InChIKey | IWNYYCUQTQGGQX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |