C23H24ClFN2 — CID 46032674
2-[(3-chloro-4-fluorophenyl)methyl]-1-(2,5-dimethylphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 46032674) has the molecular formula C23H24ClFN2 and a molecular weight of 382.91 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-1-(2,5-dimethylphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-(2,5-dimethylphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 46032674 |
| Molecular Formula | C23H24ClFN2 |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-(2,5-dimethylphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | Cc1ccc(C)c(C2c3cccn3CCCN2Cc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C23H24ClFN2/c1-16-6-7-17(2)19(13-16)23-22-5-3-10-26(22)11-4-12-27(23)15-18-8-9-21(25)20(24)14-18/h3,5-10,13-14,23H,4,11-12,15H2,1-2H3 |
| InChIKey | CNRJJKQENLCYIB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |