C22H24N2O2 — CID 46032859
2-[[1-(3-hydroxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol (PubChem CID 46032859) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[1-(3-hydroxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol.
| Compound Name | 2-[[1-(3-hydroxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 46032859 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[[1-(3-hydroxyphenyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepin-2-yl]methyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(CN2CCCn3cccc3C2c2cccc(O)c2)c1 |
| InChI | InChI=1S/C22H24N2O2/c1-16-8-9-21(26)18(13-16)15-24-12-4-11-23-10-3-7-20(23)22(24)17-5-2-6-19(25)14-17/h2-3,5-10,13-14,22,25-26H,4,11-12,15H2,1H3 |
| InChIKey | RQQAADUBJADPIC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|