C21H30N2O2 — CID 46036734
1-(3,5-dimethoxyphenyl)-2-(3-methylbutyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine (PubChem CID 46036734) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-2-(3-methylbutyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine.
| Compound Name | 1-(3,5-dimethoxyphenyl)-2-(3-methylbutyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 46036734 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-2-(3-methylbutyl)-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine |
| SMILES | COc1cc(OC)cc(C2c3cccn3CCCN2CCC(C)C)c1 |
| InChI | InChI=1S/C21H30N2O2/c1-16(2)8-12-23-11-6-10-22-9-5-7-20(22)21(23)17-13-18(24-3)15-19(14-17)25-4/h5,7,9,13-16,21H,6,8,10-12H2,1-4H3 |
| InChIKey | NWWXHXCVELJTOC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |