C25H24N6O2 — CID 4603691
N'-(3,4-dihydro-2H-pyrrol-5-yl)-6-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 4603691) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-pyrrol-5-yl)-6-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-6-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 4603691 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N'-(3,4-dihydro-2H-pyrrol-5-yl)-6-(4-methoxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | COc1ccc(-c2cc(C(=O)NNC3=NCCC3)c3c(C)nn(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C25H24N6O2/c1-16-23-20(25(32)29-28-22-9-6-14-26-22)15-21(17-10-12-19(33-2)13-11-17)27-24(23)31(30-16)18-7-4-3-5-8-18/h3-5,7-8,10-13,15H,6,9,14H2,1-2H3,(H,26,28)(H,29,32) |
| InChIKey | CZZLEPWAAKSFKT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|