C20H22N2OS — CID 46039553
4-[(E)-but-2-enyl]-2-methyl-N-[(3-methylphenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 46039553) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 4-[(E)-but-2-enyl]-2-methyl-N-[(3-methylphenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | 4-[(E)-but-2-enyl]-2-methyl-N-[(3-methylphenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 46039553 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-[(E)-but-2-enyl]-2-methyl-N-[(3-methylphenyl)methyl]thieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | C/C=C/Cn1c(C(=O)NCc2cccc(C)c2)cc2sc(C)cc21 |
| InChI | InChI=1S/C20H22N2OS/c1-4-5-9-22-17-11-15(3)24-19(17)12-18(22)20(23)21-13-16-8-6-7-14(2)10-16/h4-8,10-12H,9,13H2,1-3H3,(H,21,23)/b5-4+ |
| InChIKey | UQTIYHKWLGTCLQ-SNAWJCMRSA-N |
| XLogP | 4.83 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|