C12H12N2S — CID 4604177
3-phenyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine (PubChem CID 4604177) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 3-phenyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine.
| Compound Name | 3-phenyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine |
|---|---|
| PubChem CID | 4604177 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-phenyl-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine |
| SMILES | C1=C(c2ccccc2)N2CCCN=C2S1 |
| InChI | InChI=1S/C12H12N2S/c1-2-5-10(6-3-1)11-9-15-12-13-7-4-8-14(11)12/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | XZWPLVUQTBSUBV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |