C25H29N3O4 — CID 46042535
3-[1-(4-methoxyphenyl)-3-methyl-5-phenoxypyrazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 46042535) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)-3-methyl-5-phenoxypyrazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-[1-(4-methoxyphenyl)-3-methyl-5-phenoxypyrazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 46042535 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)-3-methyl-5-phenoxypyrazol-4-yl]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | COc1ccc(-n2nc(C)c(CCC(=O)NCC3CCCO3)c2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-18-23(14-15-24(29)26-17-22-9-6-16-31-22)25(32-21-7-4-3-5-8-21)28(27-18)19-10-12-20(30-2)13-11-19/h3-5,7-8,10-13,22H,6,9,14-17H2,1-2H3,(H,26,29) |
| InChIKey | PMZNVYZDNBWUKA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |