C23H25FN4O2 — CID 46043247
2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(4-fluorophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 46043247) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(4-fluorophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(4-fluorophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46043247 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-N-(4-fluorophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccc(N2CCN(Cc3nc(C(=O)Nc4ccc(F)cc4)co3)CC2)cc1C |
| InChI | InChI=1S/C23H25FN4O2/c1-16-3-8-20(13-17(16)2)28-11-9-27(10-12-28)14-22-26-21(15-30-22)23(29)25-19-6-4-18(24)5-7-19/h3-8,13,15H,9-12,14H2,1-2H3,(H,25,29) |
| InChIKey | WUVCFOFCBQYYND-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|