C18H16ClN3O3 — CID 4604410
N-(3-chloro-2-methylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide (PubChem CID 4604410) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
|---|---|
| PubChem CID | 4604410 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-4-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)butanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCCN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C18H16ClN3O3/c1-11-13(19)6-2-7-14(11)21-15(23)8-4-10-22-17(24)12-5-3-9-20-16(12)18(22)25/h2-3,5-7,9H,4,8,10H2,1H3,(H,21,23) |
| InChIKey | GOZFEGLJABQWIK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|